* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KB 2317 |
| EnglishSynonyms: | RARECHEM AN KB 2317 |
| pro_mdlNumber: | MFCD08452508 |
| pro_acceptors: | 2 |
| pro_donors: | 2 |
| pro_smile: | CCC(Cc1c2ccccc2c(c3c1cccc3)CC(C)N)N.Cl.Cl |
| InChi: | InChI=1S/C21H26N2.2ClH/c1-3-15(23)13-21-18-10-6-4-8-16(18)20(12-14(2)22)17-9-5-7-11-19(17)21;;/h4-11,14-15H,3,12-13,22-23H2,1-2H3;2*1H |
| InChiKey: | InChIKey=HLWBTEXIOXCOJQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.