* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KB 2332 |
| EnglishSynonyms: | RARECHEM AN KB 2332 |
| pro_mdlNumber: | MFCD08452517 |
| pro_acceptors: | 4 |
| pro_donors: | 4 |
| pro_smile: | CCC(Cc1ccc(cc1O)Nc2ccc(cc2)N)N.Cl |
| InChi: | InChI=1S/C16H21N3O.ClH/c1-2-12(17)9-11-3-6-15(10-16(11)20)19-14-7-4-13(18)5-8-14;/h3-8,10,12,19-20H,2,9,17-18H2,1H3;1H |
| InChiKey: | InChIKey=XUSMPXYACZLLAH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.