* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KB 2335 |
| EnglishSynonyms: | RARECHEM AN KB 2335 |
| pro_mdlNumber: | MFCD08452519 |
| pro_acceptors: | 2 |
| pro_donors: | 2 |
| pro_smile: | CCC(Cc1ccc(cc1)N)N.Cl |
| InChi: | InChI=1S/C10H16N2.ClH/c1-2-9(11)7-8-3-5-10(12)6-4-8;/h3-6,9H,2,7,11-12H2,1H3;1H |
| InChiKey: | InChIKey=VMMUPSFBVLRQNC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.