* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KC 0490 |
| EnglishSynonyms: | RARECHEM AN KC 0490 |
| pro_mdlNumber: | MFCD08452936 |
| pro_acceptors: | 4 |
| pro_donors: | 0 |
| pro_smile: | CCCc1c(nn(c1Sc2ccccc2C(=O)OC)C)C(F)(F)F |
| InChi: | InChI=1S/C16H17F3N2O2S/c1-4-7-11-13(16(17,18)19)20-21(2)14(11)24-12-9-6-5-8-10(12)15(22)23-3/h5-6,8-9H,4,7H2,1-3H3 |
| InChiKey: | InChIKey=KEPNOTJZQDGADF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.