* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KC 1559 |
| EnglishSynonyms: | RARECHEM AN KC 1559 |
| pro_mdlNumber: | MFCD08453779 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | CC(Cc1cc(ccc1OC)C(F)(F)F)N |
| InChi: | InChI=1S/C11H14F3NO/c1-7(15)5-8-6-9(11(12,13)14)3-4-10(8)16-2/h3-4,6-7H,5,15H2,1-2H3 |
| InChiKey: | InChIKey=NUNGTENDWCSZIC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.