* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KC 2111 |
| EnglishSynonyms: | RARECHEM AN KC 2111 |
| pro_mdlNumber: | MFCD08454321 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | CCOCc1ccc(c(c1)CC(C)N)OC |
| InChi: | InChI=1S/C13H21NO2/c1-4-16-9-11-5-6-13(15-3)12(8-11)7-10(2)14/h5-6,8,10H,4,7,9,14H2,1-3H3 |
| InChiKey: | InChIKey=SXRICQSCZNAJNC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.