* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KC 2128 |
| EnglishSynonyms: | RARECHEM AN KC 2128 |
| pro_mdlNumber: | MFCD08454338 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | CCCOc1c(cc(cc1CC)CC(C)N)C |
| InChi: | InChI=1S/C15H25NO/c1-5-7-17-15-11(3)8-13(9-12(4)16)10-14(15)6-2/h8,10,12H,5-7,9,16H2,1-4H3 |
| InChiKey: | InChIKey=AMYSVIMEYUUGLJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.