* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KC 2172 |
| EnglishSynonyms: | RARECHEM AN KC 2172 |
| pro_mdlNumber: | MFCD08454382 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | CCCc1cc(ccc1OCCC)CC(C)N |
| InChi: | InChI=1S/C15H25NO/c1-4-6-14-11-13(10-12(3)16)7-8-15(14)17-9-5-2/h7-8,11-12H,4-6,9-10,16H2,1-3H3 |
| InChiKey: | InChIKey=JFDQVPCOLPWUCH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.