* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KC 2216 |
| EnglishSynonyms: | RARECHEM AN KC 2216 |
| pro_mdlNumber: | MFCD08454426 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | CC(Cc1cc2cc(ccc2n1C)Cl)N |
| InChi: | InChI=1S/C12H15ClN2/c1-8(14)5-11-7-9-6-10(13)3-4-12(9)15(11)2/h3-4,6-8H,5,14H2,1-2H3 |
| InChiKey: | InChIKey=RORTVABFBQXYPI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.