* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KC 2233 |
| EnglishSynonyms: | RARECHEM AN KC 2233 |
| pro_mdlNumber: | MFCD08454443 |
| pro_acceptors: | 2 |
| pro_donors: | 2 |
| pro_smile: | Cc1c(ccc2c1[nH]c(c2)CC(C)N)F |
| InChi: | InChI=1S/C12H15FN2/c1-7(14)5-10-6-9-3-4-11(13)8(2)12(9)15-10/h3-4,6-7,15H,5,14H2,1-2H3 |
| InChiKey: | InChIKey=NMLQNVDARBOFHN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.