* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KC 2275 |
| EnglishSynonyms: | RARECHEM AN KC 2275 |
| pro_mdlNumber: | MFCD08454470 |
| pro_acceptors: | 1 |
| pro_donors: | 1 |
| pro_smile: | CCC(C)CCCC/C=C\CCCCCCCC(C)N |
| InChi: | InChI=1S/C19H39N/c1-4-18(2)16-14-12-10-8-6-5-7-9-11-13-15-17-19(3)20/h6,8,18-19H,4-5,7,9-17,20H2,1-3H3/b8-6- |
| InChiKey: | InChIKey=BBGNDZUDFJPGCW-VURMDHGXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.