* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KD 0037 |
| EnglishSynonyms: | RARECHEM AN KD 0037 |
| pro_mdlNumber: | MFCD08454597 |
| pro_acceptors: | 5 |
| pro_donors: | 2 |
| pro_smile: | COc1cc(ccc1OC(=O)C2CC2)CC(CO)N.Cl |
| InChi: | InChI=1S/C14H19NO4.ClH/c1-18-13-7-9(6-11(15)8-16)2-5-12(13)19-14(17)10-3-4-10;/h2,5,7,10-11,16H,3-4,6,8,15H2,1H3;1H |
| InChiKey: | InChIKey=FXIDZMKOYXKQHW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.