* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KD 0050 |
| EnglishSynonyms: | RARECHEM AN KD 0050 |
| pro_mdlNumber: | MFCD08454606 |
| pro_acceptors: | 5 |
| pro_donors: | 2 |
| pro_smile: | COc1cc(ccc1CC(CO)N)OC2CCCCO2.Cl |
| InChi: | InChI=1S/C15H23NO4.ClH/c1-18-14-9-13(20-15-4-2-3-7-19-15)6-5-11(14)8-12(16)10-17;/h5-6,9,12,15,17H,2-4,7-8,10,16H2,1H3;1H |
| InChiKey: | InChIKey=FANQPKQFOILGPV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.