* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KD 0055 |
| EnglishSynonyms: | RARECHEM AN KD 0055 |
| pro_mdlNumber: | MFCD08454611 |
| pro_acceptors: | 4 |
| pro_donors: | 4 |
| pro_smile: | c1cc(cc(c1)C(=N)N)CC(CO)N.Cl.Cl |
| InChi: | InChI=1S/C10H15N3O.2ClH/c11-9(6-14)5-7-2-1-3-8(4-7)10(12)13;;/h1-4,9,14H,5-6,11H2,(H3,12,13);2*1H |
| InChiKey: | InChIKey=ACUZRXMYPCEVCH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.