* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KD 0533 |
| EnglishSynonyms: | RARECHEM AN KD 0533 |
| pro_mdlNumber: | MFCD08455010 |
| pro_acceptors: | 4 |
| pro_donors: | 3 |
| pro_smile: | Cc1c([nH]cn1)CC(CO)N.Cl |
| InChi: | InChI=1S/C7H13N3O.ClH/c1-5-7(10-4-9-5)2-6(8)3-11;/h4,6,11H,2-3,8H2,1H3,(H,9,10);1H |
| InChiKey: | InChIKey=XGFUBVSRJIMDEC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.