* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KD 0566 |
| EnglishSynonyms: | RARECHEM AN KD 0566 |
| pro_mdlNumber: | MFCD08455036 |
| pro_acceptors: | 4 |
| pro_donors: | 3 |
| pro_smile: | c1cc(cc(c1)OCCO)CC(CO)N.Cl |
| InChi: | InChI=1S/C11H17NO3.ClH/c12-10(8-14)6-9-2-1-3-11(7-9)15-5-4-13;/h1-3,7,10,13-14H,4-6,8,12H2;1H |
| InChiKey: | InChIKey=PUXMREUIJFXBHZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.