* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KD 0651 |
| EnglishSynonyms: | RARECHEM AN KD 0651 |
| pro_mdlNumber: | MFCD08455112 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | Cc1ccc(cc1)c2c3cc(ccc3no2)CC(CO)N.Cl |
| InChi: | InChI=1S/C17H18N2O2.ClH/c1-11-2-5-13(6-3-11)17-15-9-12(8-14(18)10-20)4-7-16(15)19-21-17;/h2-7,9,14,20H,8,10,18H2,1H3;1H |
| InChiKey: | InChIKey=DMCJBVTVCXCECH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.