* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KD 0877 |
| EnglishSynonyms: | RARECHEM AN KD 0877 |
| pro_mdlNumber: | MFCD08455302 |
| pro_acceptors: | 5 |
| pro_donors: | 3 |
| pro_smile: | C(c1c(nc(nc1Cl)N)Cl)C(CO)N.Cl |
| InChi: | InChI=1S/C7H10Cl2N4O.ClH/c8-5-4(1-3(10)2-14)6(9)13-7(11)12-5;/h3,14H,1-2,10H2,(H2,11,12,13);1H |
| InChiKey: | InChIKey=XPPZXDJBZCHVTI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.