* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KD 1454 |
| EnglishSynonyms: | RARECHEM AN KD 1454 |
| pro_mdlNumber: | MFCD08455761 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | c1cc(c2cccnc2c1)CC(CO)N.Cl |
| InChi: | InChI=1S/C12H14N2O.ClH/c13-10(8-15)7-9-3-1-5-12-11(9)4-2-6-14-12;/h1-6,10,15H,7-8,13H2;1H |
| InChiKey: | InChIKey=JPDLDYCBVOUSSB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.