* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KD 1497 |
| EnglishSynonyms: | RARECHEM AN KD 1497 |
| pro_mdlNumber: | MFCD08455796 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | CCCOc1c(cccn1)CC(CO)N.Cl |
| InChi: | InChI=1S/C11H18N2O2.ClH/c1-2-6-15-11-9(4-3-5-13-11)7-10(12)8-14;/h3-5,10,14H,2,6-8,12H2,1H3;1H |
| InChiKey: | InChIKey=MXEILIZRKNJIGD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.