* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KD 1571 |
| EnglishSynonyms: | RARECHEM AN KD 1571 |
| pro_mdlNumber: | MFCD08455844 |
| pro_acceptors: | 2 |
| pro_donors: | 2 |
| pro_smile: | c1cc(c(cc1Cl)C(F)(F)F)CC(CO)N.Cl |
| InChi: | InChI=1S/C10H11ClF3NO.ClH/c11-7-2-1-6(3-8(15)5-16)9(4-7)10(12,13)14;/h1-2,4,8,16H,3,5,15H2;1H |
| InChiKey: | InChIKey=XBYDMNWVJVHWFZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.