* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KD 1612 |
| EnglishSynonyms: | RARECHEM AN KD 1612 |
| pro_mdlNumber: | MFCD08455885 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | Cc1c(cnn1C)CC(C)N.Cl |
| InChi: | InChI=1S/C8H15N3.ClH/c1-6(9)4-8-5-10-11(3)7(8)2;/h5-6H,4,9H2,1-3H3;1H |
| InChiKey: | InChIKey=FFKUTVBVHICPEO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.