* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KD 1721 |
| EnglishSynonyms: | RARECHEM AN KD 1721 |
| pro_mdlNumber: | MFCD08455992 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | CC(CC(C)(C)CN1CCN(CC1)C)N.Cl |
| InChi: | InChI=1S/C12H27N3.ClH/c1-11(13)9-12(2,3)10-15-7-5-14(4)6-8-15;/h11H,5-10,13H2,1-4H3;1H |
| InChiKey: | InChIKey=FSDJIORXGSJVKN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.