* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KD 2303 |
| EnglishSynonyms: | RARECHEM AN KD 2303 |
| pro_mdlNumber: | MFCD08456539 |
| pro_acceptors: | 1 |
| pro_donors: | 1 |
| pro_smile: | CC(CCCCCc1ccc(cc1)c2ccccc2)N.Cl |
| InChi: | InChI=1S/C19H25N.ClH/c1-16(20)8-4-2-5-9-17-12-14-19(15-13-17)18-10-6-3-7-11-18;/h3,6-7,10-16H,2,4-5,8-9,20H2,1H3;1H |
| InChiKey: | InChIKey=RSDGFGDMGBRVIC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.