* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KD 2332 |
| EnglishSynonyms: | RARECHEM AN KD 2332 |
| pro_mdlNumber: | MFCD08456561 |
| pro_acceptors: | 2 |
| pro_donors: | 2 |
| pro_smile: | CC(Cc1cccc(c1)N)N.Cl |
| InChi: | InChI=1S/C9H14N2.ClH/c1-7(10)5-8-3-2-4-9(11)6-8;/h2-4,6-7H,5,10-11H2,1H3;1H |
| InChiKey: | InChIKey=GZBGQXXURCHFAI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.