* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KD 2347 |
| EnglishSynonyms: | RARECHEM AN KD 2347 |
| pro_mdlNumber: | MFCD08456569 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | CC(Cc1cc[nH]n1)N.Cl |
| InChi: | InChI=1S/C6H11N3.ClH/c1-5(7)4-6-2-3-8-9-6;/h2-3,5H,4,7H2,1H3,(H,8,9);1H |
| InChiKey: | InChIKey=SVUDRZCAVSERIY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.