* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ TC 1056 |
| EnglishSynonyms: | RARECHEM AQ TC 1056 |
| pro_mdlNumber: | MFCD08456662 |
| pro_acceptors: | 4 |
| pro_donors: | 0 |
| pro_smile: | CC1(C(=NN=C2[C@H]3C[C@@H]4C[C@H](C3)C[C@H]2C4)C(N=N1)(C)C)C |
| InChi: | InChI=1S/C17H26N4/c1-16(2)15(17(3,4)21-20-16)19-18-14-12-6-10-5-11(8-12)9-13(14)7-10/h10-13H,5-9H2,1-4H3/b18-14-/t10-,11+,12-,13+ |
| InChiKey: | InChIKey=AEZJBTKVRNBOHJ-KOQONJJXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.