* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AX KI 1012 |
| EnglishSynonyms: | RARECHEM AX KI 1012 |
| pro_mdlNumber: | MFCD08456663 |
| pro_acceptors: | 8 |
| pro_donors: | 5 |
| pro_smile: | Cc1ccc(cc1)S(C)(C)NC(=N)NCCC[C@@H](CC(=O)O)NC(=O)OC(C)(C)C |
| InChi: | InChI=1S/C21H36N4O4S/c1-15-9-11-17(12-10-15)30(5,6)25-19(22)23-13-7-8-16(14-18(26)27)24-20(28)29-21(2,3)4/h9-12,16H,7-8,13-14H2,1-6H3,(H,24,28)(H,26,27)(H3,22,23,25)/t16-/m0/s1 |
| InChiKey: | InChIKey=IRVPOVFUVJIIIN-INIZCTEOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.