* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AX KI 1042 |
| EnglishSynonyms: | RARECHEM AX KI 1042 |
| pro_mdlNumber: | MFCD08456677 |
| pro_acceptors: | 1 |
| pro_donors: | 1 |
| pro_smile: | c1cc(c(c(c1)N)Cl)C(F)(F)F.Cl |
| InChi: | InChI=1S/C7H5ClF3N.ClH/c8-6-4(7(9,10)11)2-1-3-5(6)12;/h1-3H,12H2;1H |
| InChiKey: | InChIKey=NHYURMPQQQETRS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.