* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM BW GA 0302 |
| EnglishSynonyms: | RARECHEM BW GA 0302 |
| pro_mdlNumber: | MFCD08456694 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | c1cc2c(cccc2OCCCl)c(c1)O |
| InChi: | InChI=1S/C12H11ClO2/c13-7-8-15-12-6-2-3-9-10(12)4-1-5-11(9)14/h1-6,14H,7-8H2 |
| InChiKey: | InChIKey=CRTIVPFAEXOTKK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.