* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | XYLITE-13C5 |
| EnglishSynonyms: | XYLITOL-13C5 ; XYLITE-13C5 ; [UL-13C5]XYLITOL |
| pro_mdlNumber: | MFCD08459674 |
| pro_acceptors: | 5 |
| pro_donors: | 5 |
| pro_smile: | [13CH2]([13C@H]([13C@@H]([13C@H]([13CH2]O)O)O)O)O |
| InChi: | InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5+/i1+1,2+1,3+1,4+1,5+1 |
| InChiKey: | InChIKey=HEBKCHPVOIAQTA-FCLZTKDGSA-N |
|
|
| MeltingPoint: | 94-97 DEG C(LIT) |
| Comments: | ASSAY METHOD: CP MASS SHIFT: M+5 WGK: 2 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 157.06 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.