* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | DIISOPROPYL-13C6 ETHER |
| CAS: | 1173021-65-2 |
| EnglishSynonyms: | ISOPROPYL-13C6 ETHER ; DIISOPROPYL-13C6 ETHER |
| pro_mdlNumber: | MFCD08702903 |
| pro_acceptors: | 1 |
| pro_donors: | 0 |
| pro_smile: | [13CH3][13CH]([13CH3])O[13CH]([13CH3])[13CH3] |
| InChi: | InChI=1S/C6H14O/c1-5(2)7-6(3)4/h5-6H,1-4H3/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChiKey: | InChIKey=ZAFNJMIOTHYJRJ-IDEBNGHGSA-N |
|
|
| Boiling_Point: | 68-69 DEG C(LIT) |
| Density: | DENSITY: 0.725 G/ML AT 25 DEG C(LIT) |
| PhysicalProperty: | FLASHPOINT: -13 DEG C FLASHPOINT: 8.6 DEG F |
| Comments: | ASSAY METHOD: CP MASS SHIFT: M+6 RIDADR: UN 1159 3/PG 2 WGK: 1 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 108.08 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.