* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | D-PROLINE-1-13C |
| EnglishSynonyms: | D-PROLINE-1-13C |
| pro_mdlNumber: | MFCD08702964 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | C1C[C@@H](NC1)[13C](=O)O |
| InChi: | InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m1/s1/i5+1 |
| InChiKey: | InChIKey=ONIBWKKTOPOVIA-VNFUZYCESA-N |
|
|
| MeltingPoint: | 223 DEG C (DEC)(LIT) |
| Comments: | MASS SHIFT: M+1 WGK: 2 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 116.12 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.