* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | DIMETHYL FUMARATE-2,3-D2 |
| CAS: | 23057-98-9 |
| EnglishSynonyms: | DIMETHYL FUMARATE-2,3-D2 |
| pro_mdlNumber: | MFCD08704934 |
| pro_acceptors: | 4 |
| pro_donors: | 0 |
| pro_smile: | [2H]/C(=C(/[2H])\C(=O)OC)/C(=O)OC |
| InChiKey: | InChIKey=null |
|
|
| MeltingPoint: | 102-106 DEG C(LIT) |
| Boiling_Point: | 192-193 DEG C(LIT) |
| Comments: | ASSAY METHOD: CP MASS SHIFT: M+2 WGK: 1 |
| Information: | ISOTOPIC PURITY: 98 ATOM % D MW: 146.10 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.