* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | GANODERIC ACID F |
| CAS: | 98665-14-6 ;98665-15-7 |
| EnglishSynonyms: | GANODERIC ACID F |
| pro_mdlNumber: | MFCD09264655 |
| pro_acceptors: | 9 |
| pro_donors: | 1 |
| pro_smile: | C[C@H](CC(=O)CC(C)C(=O)O)[C@H]1CC(=O)[C@@]2([C@@]1([C@@H](C(=O)C3=C2C(=O)C[C@@H]4[C@@]3(CCC(=O)C4(C)C)C)OC(=O)C)C)C |
| InChi: | InChI=1S/C32H42O9/c1-15(11-18(34)12-16(2)28(39)40)19-13-23(37)32(8)24-20(35)14-21-29(4,5)22(36)9-10-30(21,6)25(24)26(38)27(31(19,32)7)41-17(3)33/h15-16,19,21,27H,9-14H2,1-8H3,(H,39,40)/t15-,16?,19-,21+,27-,30+,31+,32+/m1/s1 |
| InChiKey: | InChIKey=BWCNWXLKMWWVBT-AIMUVTGPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.