* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | (+/-)-MCN 5652 |
| CAS: | 96795-89-0 |
| EnglishSynonyms: | (+/-)-MCN 5652 ; MCN 5652, (+/-) ; MCN 5652-Z |
| pro_mdlNumber: | MFCD09753376 |
| pro_acceptors: | 1 |
| pro_donors: | 0 |
| pro_smile: | CSc1ccc(cc1)[C@H]2CN3CCC[C@H]3c4c2cccc4 |
| InChi: | InChI=1S/C19H21NS/c1-21-15-10-8-14(9-11-15)18-13-20-12-4-7-19(20)17-6-3-2-5-16(17)18/h2-3,5-6,8-11,18-19H,4,7,12-13H2,1H3/t18-,19+/m1/s1 |
| InChiKey: | InChIKey=YVKDUIAAPBKHMJ-MOPGFXCFSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.