* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL MB 2072 |
| EnglishSynonyms: | RARECHEM AL MB 2072 |
| pro_mdlNumber: | MFCD09914549 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | c1cc(sc1CCCN)N2CCCCC2 |
| InChi: | InChI=1S/C12H20N2S/c13-8-4-5-11-6-7-12(15-11)14-9-2-1-3-10-14/h6-7H,1-5,8-10,13H2 |
| InChiKey: | InChIKey=ZEXYZKATVJYQQV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.