* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL MB 2078 |
| EnglishSynonyms: | RARECHEM AL MB 2078 |
| pro_mdlNumber: | MFCD09914555 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | c1ccc(c(c1)CCCN)N2CCC(CC2)O.Cl |
| InChi: | InChI=1S/C14H22N2O.ClH/c15-9-3-5-12-4-1-2-6-14(12)16-10-7-13(17)8-11-16;/h1-2,4,6,13,17H,3,5,7-11,15H2;1H |
| InChiKey: | InChIKey=NNURTMZDAGDRNT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.