* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL MB 2083 |
| EnglishSynonyms: | RARECHEM AL MB 2083 |
| pro_mdlNumber: | MFCD09914560 |
| pro_acceptors: | 2 |
| pro_donors: | 2 |
| pro_smile: | Cc1c2cc(ccc2[nH]c1CCCN)F |
| InChi: | InChI=1S/C12H15FN2/c1-8-10-7-9(13)4-5-12(10)15-11(8)3-2-6-14/h4-5,7,15H,2-3,6,14H2,1H3 |
| InChiKey: | InChIKey=YPRTZMBYCCMACX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.