* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL MD 0130 |
| EnglishSynonyms: | RARECHEM AL MD 0130 |
| pro_mdlNumber: | MFCD09916409 |
| pro_acceptors: | 5 |
| pro_donors: | 2 |
| pro_smile: | CC(C)(C)OC(=O)NC(CC(c1ccccc1)c2ccccc2)C(=O)O |
| InChi: | InChI=1S/C21H25NO4/c1-21(2,3)26-20(25)22-18(19(23)24)14-17(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,17-18H,14H2,1-3H3,(H,22,25)(H,23,24) |
| InChiKey: | InChIKey=MGMUFQKXNYVXGG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.