* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | GW 1929 HYDROCHLORIDE |
| CAS: | 196808-24-9 |
| EnglishSynonyms: | GW 1929 HYDROCHLORIDE |
| pro_mdlNumber: | MFCD09971054 |
| pro_acceptors: | 7 |
| pro_donors: | 2 |
| pro_smile: | CN(CCOc1ccc(cc1)C[C@@H](C(=O)O)Nc2ccccc2C(=O)c3ccccc3)c4ccccn4.Cl |
| InChi: | InChI=1S/C30H29N3O4.ClH/c1-33(28-13-7-8-18-31-28)19-20-37-24-16-14-22(15-17-24)21-27(30(35)36)32-26-12-6-5-11-25(26)29(34)23-9-3-2-4-10-23;/h2-18,27,32H,19-21H2,1H3,(H,35,36);1H/t27-;/m0./s1 |
| InChiKey: | InChIKey=KXNKIKXTGRMLEY-YCBFMBTMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.