* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | GR-127935 HYDROCHLORIDE HYDRATE |
| EnglishSynonyms: | GR-127935 HYDROCHLORIDE HYDRATE |
| pro_mdlNumber: | MFCD11045922 |
| pro_acceptors: | 8 |
| pro_donors: | 1 |
| pro_smile: | Cc1cc(ccc1c2ccc(cc2)C(=O)Nc3ccc(c(c3)N4CCN(CC4)C)OC)c5nc(on5)C.O.Cl |
| InChi: | InChI=1S/C29H31N5O3.ClH.H2O/c1-19-17-23(28-30-20(2)37-32-28)9-11-25(19)21-5-7-22(8-6-21)29(35)31-24-10-12-27(36-4)26(18-24)34-15-13-33(3)14-16-34;;/h5-12,17-18H,13-16H2,1-4H3,(H,31,35);1H;1H2 |
| InChiKey: | InChIKey=KSXUSAQPMSACQS-UHFFFAOYSA-N |
|
|
|
|
| secure_wgk_germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.