* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 9-FLUORO-1,2,3,4,5,6-HEXAHYDROAZEPINO[4,3-B]INDOLE |
| CAS: | 919120-68-6 |
| EnglishSynonyms: | 9-FLUORO-1H,2H,3H,4H,5H,6H-AZEPINO[4,3-B]INDOLE ; AZEPINO[4,3-B]INDOLE, 9-FLUORO-1,2,3,4,5,6-HEXAHYDRO- ; 9-FLUORO-1,2,3,4,5,6-HEXAHYDROAZEPINO[4,3-B]INDOLE |
| pro_mdlNumber: | MFCD11168374 |
| pro_acceptors: | 2 |
| pro_donors: | 2 |
| pro_smile: | c1cc2c(cc1F)c3c([nH]2)CCCNC3 |
| InChi: | InChI=1S/C12H13FN2/c13-8-3-4-12-9(6-8)10-7-14-5-1-2-11(10)15-12/h3-4,6,14-15H,1-2,5,7H2 |
| InChiKey: | InChIKey=ZFHSVILTWVPKJW-UHFFFAOYSA-N |
|
|
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.