* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | HDH-PHARMA 25395 |
| EnglishSynonyms: | HDH-PHARMA 25395 ; HDH-PHARMA 25396 ; HDH-PHARMA 25397 |
| pro_mdlNumber: | MFCD11875096 |
| pro_acceptors: | 4 |
| pro_donors: | 0 |
| pro_smile: | CC(C)(C)OC(=O)N1CCCC1COCC1=CC=C(Cl)C=C1C(F)(F)F |
| InChi: | InChI=1S/C18H23ClF3NO3/c1-17(2,3)26-16(24)23-8-4-5-14(23)11-25-10-12-6-7-13(19)9-15(12)18(20,21)22/h6-7,9,14H,4-5,8,10-11H2,1-3H3 |
| InChiKey: | InChIKey=ILOSAZCDEHTNCK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.