* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | PYRIDINE, 2,4,6-TRIMETHYL-, HYDRATE |
| CAS: | 731863-15-3 |
| EnglishSynonyms: | PYRIDINE, 2,4,6-TRIMETHYL-, HYDRATE |
| pro_mdlNumber: | MFCD13175297 |
| pro_acceptors: | 1 |
| pro_donors: | 0 |
| pro_smile: | Cc1cc(nc(c1)C)C.O |
| InChi: | InChI=1S/C8H11N.H2O/c1-6-4-7(2)9-8(3)5-6;/h4-5H,1-3H3;1H2 |
| InChiKey: | InChIKey=SBEUNUZXMYRRCL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.