* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | PHENOL, 4-(1H-IMIDAZOL-2-YL)-, 1-BENZOATE |
CAS: | 1119531-25-7 |
EnglishSynonyms: | PHENOL, 4-(1H-IMIDAZOL-2-YL)-, 1-BENZOATE |
pro_mdlNumber: | MFCD13183262 |
pro_acceptors: | 4 |
pro_donors: | 1 |
pro_smile: | c1ccc(cc1)C(=O)Oc2ccc(cc2)c3[nH]ccn3 |
InChi: | InChI=1S/C16H12N2O2/c19-16(13-4-2-1-3-5-13)20-14-8-6-12(7-9-14)15-17-10-11-18-15/h1-11H,(H,17,18) |
InChiKey: | InChIKey=HZWWTQHDTLYADM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.