* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | INDOLE-3,5,6-TRIOL, 2-IODO-, TRIACETATE |
| CAS: | 92160-53-7 |
| EnglishSynonyms: | INDOLE-3,5,6-TRIOL, 2-IODO-, TRIACETATE |
| pro_mdlNumber: | MFCD13183342 |
| pro_acceptors: | 7 |
| pro_donors: | 1 |
| pro_smile: | CC(=O)Oc1cc2c(cc1OC(=O)C)[nH]c(c2OC(=O)C)I |
| InChi: | InChI=1S/C14H12INO6/c1-6(17)20-11-4-9-10(5-12(11)21-7(2)18)16-14(15)13(9)22-8(3)19/h4-5,16H,1-3H3 |
| InChiKey: | InChIKey=YCQZBKUBCHIPKW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.