* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | D-PROLINE, 3-HYDROXY-, METHYL ESTER, (3S)- |
| CAS: | 405165-00-6 |
| EnglishSynonyms: | D-PROLINE, 3-HYDROXY-, METHYL ESTER, (3S)- |
| pro_mdlNumber: | MFCD13248610 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | COC(=O)[C@H]1[C@H](CCN1)O |
| InChi: | InChI=1S/C6H11NO3/c1-10-6(9)5-4(8)2-3-7-5/h4-5,7-8H,2-3H2,1H3/t4-,5+/m0/s1 |
| InChiKey: | InChIKey=YIKYEFZGORKEBX-CRCLSJGQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.