* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | PROLINE, 5-PHENYL-, ETHYL ESTER, CIS- |
| CAS: | 28115-35-7 |
| EnglishSynonyms: | PROLINE, 5-PHENYL-, ETHYL ESTER, CIS- |
| pro_mdlNumber: | MFCD15071968 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | CCOC(=O)[C@@H]1CC[C@@H](N1)c2ccccc2 |
| InChi: | InChI=1S/C13H17NO2/c1-2-16-13(15)12-9-8-11(14-12)10-6-4-3-5-7-10/h3-7,11-12,14H,2,8-9H2,1H3/t11-,12+/m1/s1 |
| InChiKey: | InChIKey=BJOUEZQMVVKCPC-NEPJUHHUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.