* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | PIPERIDINE, 3-[(4-METHYL-1H-IMIDAZOL-1-YL)METHYL]-, HYDROCHLORIDE (1:2), (3R)- |
| CAS: | 1139879-42-7 |
| EnglishSynonyms: | PIPERIDINE, 3-[(4-METHYL-1H-IMIDAZOL-1-YL)METHYL]-, HYDROCHLORIDE (1:2), (3R)- |
| pro_mdlNumber: | MFCD15072012 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | Cc1cn(cn1)C[C@@H]2CCCNC2.Cl.Cl |
| InChi: | InChI=1S/C10H17N3.2ClH/c1-9-6-13(8-12-9)7-10-3-2-4-11-5-10;;/h6,8,10-11H,2-5,7H2,1H3;2*1H/t10-;;/m1../s1 |
| InChiKey: | InChIKey=TZOSEWUNQNIKOQ-YQFADDPSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.